C18H22ClN7O — CID 142127059
N'-[(E)-N'-[2-(2-chlorophenyl)-5-methyl-6-morpholin-4-ylpyrimidin-4-yl]carbamimidoyl]ethanimidamide (PubChem CID 142127059) has the molecular formula C18H22ClN7O and a molecular weight of 387.88 g/mol. Its IUPAC name is N'-[(E)-N'-[2-(2-chlorophenyl)-5-methyl-6-morpholin-4-ylpyrimidin-4-yl]carbamimidoyl]ethanimidamide.
| Compound Name | N'-[(E)-N'-[2-(2-chlorophenyl)-5-methyl-6-morpholin-4-ylpyrimidin-4-yl]carbamimidoyl]ethanimidamide |
|---|---|
| PubChem CID | 142127059 |
| Molecular Formula | C18H22ClN7O |
| Molecular Weight | 387.88 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N'-[(E)-N'-[2-(2-chlorophenyl)-5-methyl-6-morpholin-4-ylpyrimidin-4-yl]carbamimidoyl]ethanimidamide |
| SMILES | C/C(N)=N/C(N)=N/c1nc(-c2ccccc2Cl)nc(N2CCOCC2)c1C |
| InChI | InChI=1S/C18H22ClN7O/c1-11-15(25-18(21)22-12(2)20)23-16(13-5-3-4-6-14(13)19)24-17(11)26-7-9-27-10-8-26/h3-6H,7-10H2,1-2H3,(H4,20,21,22,23,24,25) |
| InChIKey | DPKKSDCXSGDHGM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.88 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|