C25H30F4N4 — CID 142127464
2-amino-N-[1-[3-fluoro-2-(propylamino)phenyl]ethyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]cyclopentene-1-carboximidamide (PubChem CID 142127464) has the molecular formula C25H30F4N4 and a molecular weight of 462.54 g/mol. Its IUPAC name is 2-amino-N-[1-[3-fluoro-2-(propylamino)phenyl]ethyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]cyclopentene-1-carboximidamide.
| Compound Name | 2-amino-N-[1-[3-fluoro-2-(propylamino)phenyl]ethyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]cyclopentene-1-carboximidamide |
|---|---|
| PubChem CID | 142127464 |
| Molecular Formula | C25H30F4N4 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 2-amino-N-[1-[3-fluoro-2-(propylamino)phenyl]ethyl]-N'-[[2-(trifluoromethyl)phenyl]methyl]cyclopentene-1-carboximidamide |
| SMILES | CCCNc1c(F)cccc1C(C)N/C(=N/Cc1ccccc1C(F)(F)F)C1=C(N)CCC1 |
| InChI | InChI=1S/C25H30F4N4/c1-3-14-31-23-18(9-6-12-21(23)26)16(2)33-24(19-10-7-13-22(19)30)32-15-17-8-4-5-11-20(17)25(27,28)29/h4-6,8-9,11-12,16,31H,3,7,10,13-15,30H2,1-2H3,(H,32,33) |
| InChIKey | MRDFPRGJKBCDOE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|