C27H34F2N4 — CID 142127643
2,4-difluoro-6-propylaniline;ethane;N-methyl-2-(2-methylphenyl)-2,3-dihydro-1H-quinazolin-4-imine (PubChem CID 142127643) has the molecular formula C27H34F2N4 and a molecular weight of 452.59 g/mol. Its IUPAC name is 2,4-difluoro-6-propylaniline;ethane;N-methyl-2-(2-methylphenyl)-2,3-dihydro-1H-quinazolin-4-imine.
| Compound Name | 2,4-difluoro-6-propylaniline;ethane;N-methyl-2-(2-methylphenyl)-2,3-dihydro-1H-quinazolin-4-imine |
|---|---|
| PubChem CID | 142127643 |
| Molecular Formula | C27H34F2N4 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2,4-difluoro-6-propylaniline;ethane;N-methyl-2-(2-methylphenyl)-2,3-dihydro-1H-quinazolin-4-imine |
| SMILES | C/N=C1\NC(c2ccccc2C)Nc2ccccc21.CC.CCCc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C16H17N3.C9H11F2N.C2H6/c1-11-7-3-4-8-12(11)16-18-14-10-6-5-9-13(14)15(17-2)19-16;1-2-3-6-4-7(10)5-8(11)9(6)12;1-2/h3-10,16,18H,1-2H3,(H,17,19);4-5H,2-3,12H2,1H3;1-2H3 |
| InChIKey | CDNPBPKEPRVIJD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|