C25H31F3N4 — CID 142127831
N-[(3Z)-penta-1,3-dien-2-yl]-2-[2-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-amine;pentan-1-amine (PubChem CID 142127831) has the molecular formula C25H31F3N4 and a molecular weight of 444.55 g/mol. Its IUPAC name is N-[(3Z)-penta-1,3-dien-2-yl]-2-[2-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-amine;pentan-1-amine.
| Compound Name | N-[(3Z)-penta-1,3-dien-2-yl]-2-[2-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-amine;pentan-1-amine |
|---|---|
| PubChem CID | 142127831 |
| Molecular Formula | C25H31F3N4 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-[(3Z)-penta-1,3-dien-2-yl]-2-[2-(trifluoromethyl)phenyl]-1,2-dihydroquinazolin-4-amine;pentan-1-amine |
| SMILES | C=C(/C=C\C)NC1=NC(c2ccccc2C(F)(F)F)Nc2ccccc21.CCCCCN |
| InChI | InChI=1S/C20H18F3N3.C5H13N/c1-3-8-13(2)24-19-15-10-5-7-12-17(15)25-18(26-19)14-9-4-6-11-16(14)20(21,22)23;1-2-3-4-5-6/h3-12,18,25H,2H2,1H3,(H,24,26);2-6H2,1H3/b8-3-; |
| InChIKey | GXCCAANUUHZHQC-NGRDVXTNSA-N |
| XLogP | 6.39 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|