C23H23N5 — CID 142128023
2-(2-cyclopropylphenyl)-N-[(4R)-4-ethyl-5-methyl-4H-imidazol-2-yl]quinazolin-4-amine (PubChem CID 142128023) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-(2-cyclopropylphenyl)-N-[(4R)-4-ethyl-5-methyl-4H-imidazol-2-yl]quinazolin-4-amine.
| Compound Name | 2-(2-cyclopropylphenyl)-N-[(4R)-4-ethyl-5-methyl-4H-imidazol-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 142128023 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-(2-cyclopropylphenyl)-N-[(4R)-4-ethyl-5-methyl-4H-imidazol-2-yl]quinazolin-4-amine |
| SMILES | CC[C@H]1N=C(Nc2nc(-c3ccccc3C3CC3)nc3ccccc23)N=C1C |
| InChI | InChI=1S/C23H23N5/c1-3-19-14(2)24-23(26-19)28-22-18-10-6-7-11-20(18)25-21(27-22)17-9-5-4-8-16(17)15-12-13-15/h4-11,15,19H,3,12-13H2,1-2H3,(H,25,26,27,28)/t19-/m1/s1 |
| InChIKey | RWLKSBGPUVQAKO-LJQANCHMSA-N |
| XLogP | 5.20 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |