About 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine
1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine (PubChem CID 142128291) has the molecular formula C17H18F3N3
and a molecular weight of 321.35 g/mol. Its IUPAC name is 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine.
Molecular Properties
| Compound Name | 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine |
| PubChem CID | 142128291 |
| Molecular Formula | C17H18F3N3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine |
| SMILES | C/C=C(C1=CC(c2ccccc2)=NNN1C)\C(=C/C)C(F)(F)F |
| InChI | InChI=1S/C17H18F3N3/c1-4-13(14(5-2)17(18,19)20)16-11-15(21-22-23(16)3)12-9-7-6-8-10-12/h4-11,22H,1-3H3/b13-4+,14-5+ |
| InChIKey | PAIJFYFXKDYQKT-PCSLFHOQSA-N |
| XLogP | 4.18 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine?
The IUPAC name of 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine (CID 142128291) is 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine.
What is the SMILES notation for 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine?
The canonical SMILES for 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine is C/C=C(C1=CC(c2ccccc2)=NNN1C)\C(=C/C)C(F)(F)F.
What is the InChIKey of 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine?
The InChIKey is PAIJFYFXKDYQKT-PCSLFHOQSA-N. The full InChI is InChI=1S/C17H18F3N3/c1-4-13(14(5-2)17(18,19)20)16-11-15(21-22-23(16)3)12-9-7-6-8-10-12/h4-11,22H,1-3H3/b13-4+,14-5+.
What are the key properties of 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine?
1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine has a molecular weight of 321.35 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-phenyl-6-[(2E,4E)-4-(trifluoromethyl)hexa-2,4-dien-3-yl]-2H-triazine is sourced from PubChem (CID 142128291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).