C23H26N4 — CID 142128440
(3Z)-2-N-[2-(2-methylphenyl)quinazolin-4-yl]-4-N-propylpenta-1,3-diene-2,4-diamine (PubChem CID 142128440) has the molecular formula C23H26N4 and a molecular weight of 358.49 g/mol. Its IUPAC name is (3Z)-2-N-[2-(2-methylphenyl)quinazolin-4-yl]-4-N-propylpenta-1,3-diene-2,4-diamine.
| Compound Name | (3Z)-2-N-[2-(2-methylphenyl)quinazolin-4-yl]-4-N-propylpenta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 142128440 |
| Molecular Formula | C23H26N4 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (3Z)-2-N-[2-(2-methylphenyl)quinazolin-4-yl]-4-N-propylpenta-1,3-diene-2,4-diamine |
| SMILES | C=C(/C=C(/C)NCCC)Nc1nc(-c2ccccc2C)nc2ccccc12 |
| InChI | InChI=1S/C23H26N4/c1-5-14-24-17(3)15-18(4)25-23-20-12-8-9-13-21(20)26-22(27-23)19-11-7-6-10-16(19)2/h6-13,15,24H,4-5,14H2,1-3H3,(H,25,26,27)/b17-15- |
| InChIKey | ZFNJKFJTDQPHMO-ICFOKQHNSA-N |
| XLogP | 5.43 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|