About (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine
(5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine (PubChem CID 142128652) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine.
Molecular Properties
| Compound Name | (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine |
| PubChem CID | 142128652 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine |
| SMILES | CN1CCN(/C2=N/C=C\C=C/CC2)CC1 |
| InChI | InChI=1S/C12H19N3/c1-14-8-10-15(11-9-14)12-6-4-2-3-5-7-13-12/h2-3,5,7H,4,6,8-11H2,1H3/b3-2-,7-5-,13-12+ |
| InChIKey | NIUALCQUWYSBLG-LJJWUAPVSA-N |
| XLogP | 1.50 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine?
The IUPAC name of (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine (CID 142128652) is (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine.
What is the SMILES notation for (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine?
The canonical SMILES for (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine is CN1CCN(/C2=N/C=C\C=C/CC2)CC1.
What is the InChIKey of (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine?
The InChIKey is NIUALCQUWYSBLG-LJJWUAPVSA-N. The full InChI is InChI=1S/C12H19N3/c1-14-8-10-15(11-9-14)12-6-4-2-3-5-7-13-12/h2-3,5,7H,4,6,8-11H2,1H3/b3-2-,7-5-,13-12+.
What are the key properties of (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine?
(5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine has a molecular weight of 205.31 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7Z)-2-(4-methylpiperazin-1-yl)-3,4-dihydroazocine is sourced from PubChem (CID 142128652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).