About (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one
(3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one (PubChem CID 142128710) has the molecular formula C16H27N3O
and a molecular weight of 277.41 g/mol. Its IUPAC name is (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one.
Molecular Properties
| Compound Name | (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one |
| PubChem CID | 142128710 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one |
| SMILES | C=C/C=C\CC.Cc1c[nH]c(=O)n1C1CCN(C)CC1 |
| InChI | InChI=1S/C10H17N3O.C6H10/c1-8-7-11-10(14)13(8)9-3-5-12(2)6-4-9;1-3-5-6-4-2/h7,9H,3-6H2,1-2H3,(H,11,14);3,5-6H,1,4H2,2H3/b;6-5- |
| InChIKey | YCLKBOOKTVJHQW-JXGYXAOLSA-N |
| XLogP | 2.89 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one?
The IUPAC name of (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one (CID 142128710) is (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one.
What is the SMILES notation for (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one?
The canonical SMILES for (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one is C=C/C=C\CC.Cc1c[nH]c(=O)n1C1CCN(C)CC1.
What is the InChIKey of (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one?
The InChIKey is YCLKBOOKTVJHQW-JXGYXAOLSA-N. The full InChI is InChI=1S/C10H17N3O.C6H10/c1-8-7-11-10(14)13(8)9-3-5-12(2)6-4-9;1-3-5-6-4-2/h7,9H,3-6H2,1-2H3,(H,11,14);3,5-6H,1,4H2,2H3/b;6-5-.
What are the key properties of (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one?
(3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one has a molecular weight of 277.41 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-hexa-1,3-diene;4-methyl-3-(1-methylpiperidin-4-yl)-1H-imidazol-2-one is sourced from PubChem (CID 142128710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).