About (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole
(2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole (PubChem CID 142128908) has the molecular formula C24H19F2N
and a molecular weight of 359.42 g/mol. Its IUPAC name is (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole |
| PubChem CID | 142128908 |
| Molecular Formula | C24H19F2N |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole |
| SMILES | C=Cc1ccc(-c2ccc([C@H]3CCC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C24H19F2N/c1-2-16-6-8-17(9-7-16)18-10-12-19(13-11-18)22-14-15-23(27-22)24-20(25)4-3-5-21(24)26/h2-13,22H,1,14-15H2/t22-/m1/s1 |
| InChIKey | PNQLMPGDEHJYAN-JOCHJYFZSA-N |
| XLogP | 6.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole?
The IUPAC name of (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole (CID 142128908) is (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole?
The canonical SMILES for (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole is C=Cc1ccc(-c2ccc([C@H]3CCC(c4c(F)cccc4F)=N3)cc2)cc1.
What is the InChIKey of (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole?
The InChIKey is PNQLMPGDEHJYAN-JOCHJYFZSA-N. The full InChI is InChI=1S/C24H19F2N/c1-2-16-6-8-17(9-7-16)18-10-12-19(13-11-18)22-14-15-23(27-22)24-20(25)4-3-5-21(24)26/h2-13,22H,1,14-15H2/t22-/m1/s1.
What are the key properties of (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole?
(2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole has a molecular weight of 359.42 g/mol, XLogP of 6.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-(2,6-difluorophenyl)-2-[4-(4-ethenylphenyl)phenyl]-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 142128908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).