C23H31F2NO — CID 142128947
5-(2,6-difluorophenyl)-2-[(Z,4Z)-4-(2-ethoxypropylidene)oct-2-enyl]-3,4-dihydro-2H-pyrrole (PubChem CID 142128947) has the molecular formula C23H31F2NO and a molecular weight of 375.50 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-2-[(Z,4Z)-4-(2-ethoxypropylidene)oct-2-enyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-(2,6-difluorophenyl)-2-[(Z,4Z)-4-(2-ethoxypropylidene)oct-2-enyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 142128947 |
| Molecular Formula | C23H31F2NO |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 5-(2,6-difluorophenyl)-2-[(Z,4Z)-4-(2-ethoxypropylidene)oct-2-enyl]-3,4-dihydro-2H-pyrrole |
| SMILES | CCCCC(/C=C\CC1CCC(c2c(F)cccc2F)=N1)=C/C(C)OCC |
| InChI | InChI=1S/C23H31F2NO/c1-4-6-9-18(16-17(3)27-5-2)10-7-11-19-14-15-22(26-19)23-20(24)12-8-13-21(23)25/h7-8,10,12-13,16-17,19H,4-6,9,11,14-15H2,1-3H3/b10-7-,18-16- |
| InChIKey | WHALREIJDDOZGH-WKGYWSGVSA-N |
| XLogP | 6.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|