C24H21F4NS — CID 142128955
(2R)-2-[(1E,3E,5Z)-4-[4-(difluoromethylsulfanyl)phenyl]hepta-1,3,5-trienyl]-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 142128955) has the molecular formula C24H21F4NS and a molecular weight of 431.50 g/mol. Its IUPAC name is (2R)-2-[(1E,3E,5Z)-4-[4-(difluoromethylsulfanyl)phenyl]hepta-1,3,5-trienyl]-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | (2R)-2-[(1E,3E,5Z)-4-[4-(difluoromethylsulfanyl)phenyl]hepta-1,3,5-trienyl]-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 142128955 |
| Molecular Formula | C24H21F4NS |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (2R)-2-[(1E,3E,5Z)-4-[4-(difluoromethylsulfanyl)phenyl]hepta-1,3,5-trienyl]-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | C/C=C\C(=C/C=C/[C@H]1CCC(c2c(F)cccc2F)=N1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C24H21F4NS/c1-2-5-16(17-10-13-19(14-11-17)30-24(27)28)6-3-7-18-12-15-22(29-18)23-20(25)8-4-9-21(23)26/h2-11,13-14,18,24H,12,15H2,1H3/b5-2-,7-3+,16-6+/t18-/m0/s1 |
| InChIKey | OWESGUUUUFQPEE-QLPQFYIDSA-N |
| XLogP | 7.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|