C30H28N10O — CID 142129172
N-[[4-[hydroxy-(3-methylimidazol-4-yl)-[5-(3-methylphenyl)tetrazolo[1,5-a]quinazolin-7-yl]methyl]phenyl]methyl]-N-methyl-N'-(methylideneamino)methanimidamide (PubChem CID 142129172) has the molecular formula C30H28N10O and a molecular weight of 544.62 g/mol. Its IUPAC name is N-[[4-[hydroxy-(3-methylimidazol-4-yl)-[5-(3-methylphenyl)tetrazolo[1,5-a]quinazolin-7-yl]methyl]phenyl]methyl]-N-methyl-N'-(methylideneamino)methanimidamide.
| Compound Name | N-[[4-[hydroxy-(3-methylimidazol-4-yl)-[5-(3-methylphenyl)tetrazolo[1,5-a]quinazolin-7-yl]methyl]phenyl]methyl]-N-methyl-N'-(methylideneamino)methanimidamide |
|---|---|
| PubChem CID | 142129172 |
| Molecular Formula | C30H28N10O |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | N-[[4-[hydroxy-(3-methylimidazol-4-yl)-[5-(3-methylphenyl)tetrazolo[1,5-a]quinazolin-7-yl]methyl]phenyl]methyl]-N-methyl-N'-(methylideneamino)methanimidamide |
| SMILES | C=N/N=C\N(C)Cc1ccc(C(O)(c2ccc3c(c2)c(-c2cccc(C)c2)nc2nnnn23)c2cncn2C)cc1 |
| InChI | InChI=1S/C30H28N10O/c1-20-6-5-7-22(14-20)28-25-15-24(12-13-26(25)40-29(34-28)35-36-37-40)30(41,27-16-32-18-39(27)4)23-10-8-21(9-11-23)17-38(3)19-33-31-2/h5-16,18-19,41H,2,17H2,1,3-4H3/b33-19- |
| InChIKey | MIQAULFZWLYQLI-APTWKGOFSA-N |
| XLogP | 3.74 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|