C22H28N4O3 — CID 142129376
4-[4-[[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-1-hydroxyethyl]amino]cyclohexyl]benzene-1,3-diol (PubChem CID 142129376) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[4-[[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-1-hydroxyethyl]amino]cyclohexyl]benzene-1,3-diol.
| Compound Name | 4-[4-[[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-1-hydroxyethyl]amino]cyclohexyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 142129376 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 4-[4-[[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-1-hydroxyethyl]amino]cyclohexyl]benzene-1,3-diol |
| SMILES | Cc1cc2ncc(C(C)(O)NC3CCC(c4ccc(O)cc4O)CC3)c(C)n2n1 |
| InChI | InChI=1S/C22H28N4O3/c1-13-10-21-23-12-19(14(2)26(21)25-13)22(3,29)24-16-6-4-15(5-7-16)18-9-8-17(27)11-20(18)28/h8-12,15-16,24,27-29H,4-7H2,1-3H3 |
| InChIKey | KHCRUZPAHCLIGX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|