C23H24N2O3S — CID 142129790
N'-[(2E,4Z)-hepta-2,4-dien-3-yl]sulfanyl-3-methoxy-7-phenyl-1-benzofuran-2-carbohydrazide (PubChem CID 142129790) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is N'-[(2E,4Z)-hepta-2,4-dien-3-yl]sulfanyl-3-methoxy-7-phenyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[(2E,4Z)-hepta-2,4-dien-3-yl]sulfanyl-3-methoxy-7-phenyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 142129790 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N'-[(2E,4Z)-hepta-2,4-dien-3-yl]sulfanyl-3-methoxy-7-phenyl-1-benzofuran-2-carbohydrazide |
| SMILES | C/C=C(\C=C/CC)SNNC(=O)c1oc2c(-c3ccccc3)cccc2c1OC |
| InChI | InChI=1S/C23H24N2O3S/c1-4-6-13-17(5-2)29-25-24-23(26)22-21(27-3)19-15-10-14-18(20(19)28-22)16-11-8-7-9-12-16/h5-15,25H,4H2,1-3H3,(H,24,26)/b13-6-,17-5+ |
| InChIKey | GPPLKDNFDCELEB-WBYVORMFSA-N |
| XLogP | 5.86 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|