C16H24O — CID 142129797
ethane;8-ethyl-1,2,3,4,4a,9b-hexahydrodibenzofuran (PubChem CID 142129797) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;8-ethyl-1,2,3,4,4a,9b-hexahydrodibenzofuran.
| Compound Name | ethane;8-ethyl-1,2,3,4,4a,9b-hexahydrodibenzofuran |
|---|---|
| PubChem CID | 142129797 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | ethane;8-ethyl-1,2,3,4,4a,9b-hexahydrodibenzofuran |
| SMILES | CC.CCc1ccc2c(c1)C1CCCCC1O2 |
| InChI | InChI=1S/C14H18O.C2H6/c1-2-10-7-8-14-12(9-10)11-5-3-4-6-13(11)15-14;1-2/h7-9,11,13H,2-6H2,1H3;1-2H3 |
| InChIKey | AZKBFCHJUIMFPH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |