C22H19N3O2S2 — CID 142129833
5-[(4-methylphenyl)sulfanylamino]-N'-phenylsulfanyl-1-benzofuran-2-carbohydrazide (PubChem CID 142129833) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 5-[(4-methylphenyl)sulfanylamino]-N'-phenylsulfanyl-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-[(4-methylphenyl)sulfanylamino]-N'-phenylsulfanyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 142129833 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-[(4-methylphenyl)sulfanylamino]-N'-phenylsulfanyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1ccc(SNc2ccc3oc(C(=O)NNSc4ccccc4)cc3c2)cc1 |
| InChI | InChI=1S/C22H19N3O2S2/c1-15-7-10-19(11-8-15)28-24-17-9-12-20-16(13-17)14-21(27-20)22(26)23-25-29-18-5-3-2-4-6-18/h2-14,24-25H,1H3,(H,23,26) |
| InChIKey | KXESTLCSUVNEDL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|