C28H37ClN4 — CID 142130202
1-[7-[(1Z)-buta-1,3-dienyl]-2-chloro-6-methyl-8,9-dihydro-5H-benzo[7]annulen-5-yl]-4-[5-(1H-imidazol-5-yl)pentyl]piperazine (PubChem CID 142130202) has the molecular formula C28H37ClN4 and a molecular weight of 465.09 g/mol. Its IUPAC name is 1-[7-[(1Z)-buta-1,3-dienyl]-2-chloro-6-methyl-8,9-dihydro-5H-benzo[7]annulen-5-yl]-4-[5-(1H-imidazol-5-yl)pentyl]piperazine.
| Compound Name | 1-[7-[(1Z)-buta-1,3-dienyl]-2-chloro-6-methyl-8,9-dihydro-5H-benzo[7]annulen-5-yl]-4-[5-(1H-imidazol-5-yl)pentyl]piperazine |
|---|---|
| PubChem CID | 142130202 |
| Molecular Formula | C28H37ClN4 |
| Molecular Weight | 465.09 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 1-[7-[(1Z)-buta-1,3-dienyl]-2-chloro-6-methyl-8,9-dihydro-5H-benzo[7]annulen-5-yl]-4-[5-(1H-imidazol-5-yl)pentyl]piperazine |
| SMILES | C=C/C=C\C1=C(C)C(N2CCN(CCCCCc3cnc[nH]3)CC2)c2ccc(Cl)cc2CC1 |
| InChI | InChI=1S/C28H37ClN4/c1-3-4-8-23-10-11-24-19-25(29)12-13-27(24)28(22(23)2)33-17-15-32(16-18-33)14-7-5-6-9-26-20-30-21-31-26/h3-4,8,12-13,19-21,28H,1,5-7,9-11,14-18H2,2H3,(H,30,31)/b8-4- |
| InChIKey | MUSAVDDLPFRJKM-YWEYNIOJSA-N |
| XLogP | 6.14 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.09 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|