C26H32N2O — CID 142130560
10-[3-[(1E,4Z,6Z,9Z)-8-methylcyclodeca-1,4,6,9-tetraen-1-yl]oxypropyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole (PubChem CID 142130560) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is 10-[3-[(1E,4Z,6Z,9Z)-8-methylcyclodeca-1,4,6,9-tetraen-1-yl]oxypropyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole.
| Compound Name | 10-[3-[(1E,4Z,6Z,9Z)-8-methylcyclodeca-1,4,6,9-tetraen-1-yl]oxypropyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 142130560 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 10-[3-[(1E,4Z,6Z,9Z)-8-methylcyclodeca-1,4,6,9-tetraen-1-yl]oxypropyl]-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
| SMILES | CC1/C=C\C=C/C/C=C(OCCCc2cccc3[nH]c4c(c23)CCNCC4)\C=C/1 |
| InChI | InChI=1S/C26H32N2O/c1-20-8-4-2-3-5-11-22(14-13-20)29-19-7-10-21-9-6-12-25-26(21)23-15-17-27-18-16-24(23)28-25/h2-4,6,8-9,11-14,20,27-28H,5,7,10,15-19H2,1H3/b3-2-,8-4-,14-13-,22-11+ |
| InChIKey | LESQAHAPQJTBKV-MJPRWPJISA-N |
| XLogP | 5.40 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|