C23H31F3N2 — CID 142130665
ethane;N-methyl-2-[2-methyl-4-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]-1,2,3,7-tetrahydrocyclohepta[b]pyrrol-3-yl]ethanamine (PubChem CID 142130665) has the molecular formula C23H31F3N2 and a molecular weight of 392.51 g/mol. Its IUPAC name is ethane;N-methyl-2-[2-methyl-4-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]-1,2,3,7-tetrahydrocyclohepta[b]pyrrol-3-yl]ethanamine.
| Compound Name | ethane;N-methyl-2-[2-methyl-4-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]-1,2,3,7-tetrahydrocyclohepta[b]pyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 142130665 |
| Molecular Formula | C23H31F3N2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | ethane;N-methyl-2-[2-methyl-4-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]-1,2,3,7-tetrahydrocyclohepta[b]pyrrol-3-yl]ethanamine |
| SMILES | CC.CNCCC1C2=C(C3=CCC=CC(C(F)(F)F)=C3)C=CCC=C2NC1C |
| InChI | InChI=1S/C21H25F3N2.C2H6/c1-14-17(11-12-25-2)20-18(9-5-6-10-19(20)26-14)15-7-3-4-8-16(13-15)21(22,23)24;1-2/h4-5,7-10,13-14,17,25-26H,3,6,11-12H2,1-2H3;1-2H3 |
| InChIKey | ZWYMGRDQLJPHTJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |