About 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile
4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 142131326) has the molecular formula C13H16N2O4S
and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 142131326 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | N#CC1=CC=C(S(=O)(=O)N2CCC3(C2)OCCO3)CC1 |
| InChI | InChI=1S/C13H16N2O4S/c14-9-11-1-3-12(4-2-11)20(16,17)15-6-5-13(10-15)18-7-8-19-13/h1,3H,2,4-8,10H2 |
| InChIKey | YZUCFJHLEQYXAC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile (CID 142131326) is 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile is N#CC1=CC=C(S(=O)(=O)N2CCC3(C2)OCCO3)CC1.
What is the InChIKey of 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is YZUCFJHLEQYXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4S/c14-9-11-1-3-12(4-2-11)20(16,17)15-6-5-13(10-15)18-7-8-19-13/h1,3H,2,4-8,10H2.
What are the key properties of 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile?
4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 296.35 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dioxa-7-azaspiro[4.4]nonan-7-ylsulfonyl)cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 142131326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).