C36H37N5O4S — CID 142131961
formic acid;4-[[3-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxobenzimidazol-1-yl]methyl]-N-(2-methylphenyl)sulfanylbenzamide (PubChem CID 142131961) has the molecular formula C36H37N5O4S and a molecular weight of 635.79 g/mol. Its IUPAC name is formic acid;4-[[3-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxobenzimidazol-1-yl]methyl]-N-(2-methylphenyl)sulfanylbenzamide.
| Compound Name | formic acid;4-[[3-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxobenzimidazol-1-yl]methyl]-N-(2-methylphenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 142131961 |
| Molecular Formula | C36H37N5O4S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | formic acid;4-[[3-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxobenzimidazol-1-yl]methyl]-N-(2-methylphenyl)sulfanylbenzamide |
| SMILES | Cc1ccccc1SNC(=O)c1ccc(Cn2c(=O)n(Cc3nc4ccccc4n3CCC(C)C)c3ccccc32)cc1.O=CO |
| InChI | InChI=1S/C35H35N5O2S.CH2O2/c1-24(2)20-21-38-29-12-6-5-11-28(29)36-33(38)23-40-31-14-8-7-13-30(31)39(35(40)42)22-26-16-18-27(19-17-26)34(41)37-43-32-15-9-4-10-25(32)3;2-1-3/h4-19,24H,20-23H2,1-3H3,(H,37,41);1H,(H,2,3) |
| InChIKey | HIZOGQFFHJPYJJ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|