About N-(5,5-dihydroxypentyl)-N-methylethanimidamide
N-(5,5-dihydroxypentyl)-N-methylethanimidamide (PubChem CID 142132180) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is N-(5,5-dihydroxypentyl)-N-methylethanimidamide.
Molecular Properties
| Compound Name | N-(5,5-dihydroxypentyl)-N-methylethanimidamide |
| PubChem CID | 142132180 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | N-(5,5-dihydroxypentyl)-N-methylethanimidamide |
| SMILES | [H]/N=C(\C)N(C)CCCCC(O)O |
| InChI | InChI=1S/C8H18N2O2/c1-7(9)10(2)6-4-3-5-8(11)12/h8-9,11-12H,3-6H2,1-2H3/b9-7+ |
| InChIKey | FZVNTBLAXVBMKP-VQHVLOKHSA-N |
| XLogP | 0.40 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(5,5-dihydroxypentyl)-N-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5-dihydroxypentyl)-N-methylethanimidamide?
The IUPAC name of N-(5,5-dihydroxypentyl)-N-methylethanimidamide (CID 142132180) is N-(5,5-dihydroxypentyl)-N-methylethanimidamide.
What is the SMILES notation for N-(5,5-dihydroxypentyl)-N-methylethanimidamide?
The canonical SMILES for N-(5,5-dihydroxypentyl)-N-methylethanimidamide is [H]/N=C(\C)N(C)CCCCC(O)O.
What is the InChIKey of N-(5,5-dihydroxypentyl)-N-methylethanimidamide?
The InChIKey is FZVNTBLAXVBMKP-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-7(9)10(2)6-4-3-5-8(11)12/h8-9,11-12H,3-6H2,1-2H3/b9-7+.
What are the key properties of N-(5,5-dihydroxypentyl)-N-methylethanimidamide?
N-(5,5-dihydroxypentyl)-N-methylethanimidamide has a molecular weight of 174.24 g/mol, XLogP of 0.40, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5-dihydroxypentyl)-N-methylethanimidamide is sourced from PubChem (CID 142132180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).