About ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine
ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine (PubChem CID 142132343) has the molecular formula C15H34N4
and a molecular weight of 270.46 g/mol. Its IUPAC name is ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine |
| PubChem CID | 142132343 |
| Molecular Formula | C15H34N4 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.28 |
| IUPAC Name | ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine |
| SMILES | CC.[H]/N=C(\C)N1CCN(C(CC)CCN(C)C)CC1 |
| InChI | InChI=1S/C13H28N4.C2H6/c1-5-13(6-7-15(3)4)17-10-8-16(9-11-17)12(2)14;1-2/h13-14H,5-11H2,1-4H3;1-2H3/b14-12+; |
| InChIKey | UBQKWSDREJFIKQ-UNGNXWFZSA-N |
| XLogP | 2.36 |
| TPSA | 33.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine?
The IUPAC name of ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine (CID 142132343) is ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine.
What is the SMILES notation for ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine?
The canonical SMILES for ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine is CC.[H]/N=C(\C)N1CCN(C(CC)CCN(C)C)CC1.
What is the InChIKey of ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine?
The InChIKey is UBQKWSDREJFIKQ-UNGNXWFZSA-N. The full InChI is InChI=1S/C13H28N4.C2H6/c1-5-13(6-7-15(3)4)17-10-8-16(9-11-17)12(2)14;1-2/h13-14H,5-11H2,1-4H3;1-2H3/b14-12+;.
What are the key properties of ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine?
ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine has a molecular weight of 270.46 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(4-ethanimidoylpiperazin-1-yl)-N,N-dimethylpentan-1-amine is sourced from PubChem (CID 142132343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).