About butan-2-imine;ethane
butan-2-imine;ethane (PubChem CID 142132465) has the molecular formula C6H15N
and a molecular weight of 101.19 g/mol. Its IUPAC name is butan-2-imine;ethane.
Molecular Properties
| Compound Name | butan-2-imine;ethane |
| PubChem CID | 142132465 |
| Molecular Formula | C6H15N |
| Molecular Weight | 101.19 g/mol |
| Exact Mass | 101.12 |
| IUPAC Name | butan-2-imine;ethane |
| SMILES | CC.[H]/N=C(\C)CC |
| InChI | InChI=1S/C4H9N.C2H6/c1-3-4(2)5;1-2/h5H,3H2,1-2H3;1-2H3/b5-4+; |
| InChIKey | ADFGZKMOYWJNKV-FXRZFVDSSA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-imine;ethane?
The IUPAC name of butan-2-imine;ethane (CID 142132465) is butan-2-imine;ethane.
What is the SMILES notation for butan-2-imine;ethane?
The canonical SMILES for butan-2-imine;ethane is CC.[H]/N=C(\C)CC.
What is the InChIKey of butan-2-imine;ethane?
The InChIKey is ADFGZKMOYWJNKV-FXRZFVDSSA-N. The full InChI is InChI=1S/C4H9N.C2H6/c1-3-4(2)5;1-2/h5H,3H2,1-2H3;1-2H3/b5-4+;.
What are the key properties of butan-2-imine;ethane?
butan-2-imine;ethane has a molecular weight of 101.19 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-imine;ethane is sourced from PubChem (CID 142132465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).