About 5-propoxypentan-2-imine
5-propoxypentan-2-imine (PubChem CID 142132478) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 5-propoxypentan-2-imine.
Molecular Properties
| Compound Name | 5-propoxypentan-2-imine |
| PubChem CID | 142132478 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 5-propoxypentan-2-imine |
| SMILES | [H]/N=C(\C)CCCOCCC |
| InChI | InChI=1S/C8H17NO/c1-3-6-10-7-4-5-8(2)9/h9H,3-7H2,1-2H3/b9-8+ |
| InChIKey | XGWNMILBABTYGT-CMDGGOBGSA-N |
| XLogP | 2.23 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-propoxypentan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propoxypentan-2-imine?
The IUPAC name of 5-propoxypentan-2-imine (CID 142132478) is 5-propoxypentan-2-imine.
What is the SMILES notation for 5-propoxypentan-2-imine?
The canonical SMILES for 5-propoxypentan-2-imine is [H]/N=C(\C)CCCOCCC.
What is the InChIKey of 5-propoxypentan-2-imine?
The InChIKey is XGWNMILBABTYGT-CMDGGOBGSA-N. The full InChI is InChI=1S/C8H17NO/c1-3-6-10-7-4-5-8(2)9/h9H,3-7H2,1-2H3/b9-8+.
What are the key properties of 5-propoxypentan-2-imine?
5-propoxypentan-2-imine has a molecular weight of 143.23 g/mol, XLogP of 2.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propoxypentan-2-imine is sourced from PubChem (CID 142132478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).