C35H56O4 — CID 142132780
4-[(4,4,6a,6b,8a,14b-hexamethyl-12-prop-1-en-2-yl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picen-3-yl)oxy]-4-oxobutanoic acid (PubChem CID 142132780) has the molecular formula C35H56O4 and a molecular weight of 540.83 g/mol. Its IUPAC name is 4-[(4,4,6a,6b,8a,14b-hexamethyl-12-prop-1-en-2-yl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picen-3-yl)oxy]-4-oxobutanoic acid.
| Compound Name | 4-[(4,4,6a,6b,8a,14b-hexamethyl-12-prop-1-en-2-yl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picen-3-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 142132780 |
| Molecular Formula | C35H56O4 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.42 |
| IUPAC Name | 4-[(4,4,6a,6b,8a,14b-hexamethyl-12-prop-1-en-2-yl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picen-3-yl)oxy]-4-oxobutanoic acid |
| SMILES | C=C(C)C1CCCC2(C)CCC3(C)C(CCC4C5(C)CCC(OC(=O)CCC(=O)O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C35H56O4/c1-22(2)23-10-9-17-32(5)20-21-34(7)24(30(23)32)11-12-26-33(6)18-16-27(39-29(38)14-13-28(36)37)31(3,4)25(33)15-19-35(26,34)8/h23-27,30H,1,9-21H2,2-8H3,(H,36,37) |
| InChIKey | WVIVIYFIRFUYTJ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|