C18H21FO2 — CID 142132887
2-fluoro-8,9,10-trimethyl-3,4,6,7,10,11-hexahydrocycloocta[b]chromen-12-one (PubChem CID 142132887) has the molecular formula C18H21FO2 and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-fluoro-8,9,10-trimethyl-3,4,6,7,10,11-hexahydrocycloocta[b]chromen-12-one.
| Compound Name | 2-fluoro-8,9,10-trimethyl-3,4,6,7,10,11-hexahydrocycloocta[b]chromen-12-one |
|---|---|
| PubChem CID | 142132887 |
| Molecular Formula | C18H21FO2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-fluoro-8,9,10-trimethyl-3,4,6,7,10,11-hexahydrocycloocta[b]chromen-12-one |
| SMILES | CC1=C(C)C(C)Cc2c(oc3c(c2=O)C=C(F)CC3)CC1 |
| InChI | InChI=1S/C18H21FO2/c1-10-4-6-16-14(8-11(2)12(10)3)18(20)15-9-13(19)5-7-17(15)21-16/h9,11H,4-8H2,1-3H3 |
| InChIKey | RWUXKEMZEPSZRQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|