C21H26O2 — CID 142132996
2-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(2E,4Z)-6-methylocta-2,4-dien-7-yn-3-yl]-1,3-dioxane (PubChem CID 142132996) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(2E,4Z)-6-methylocta-2,4-dien-7-yn-3-yl]-1,3-dioxane.
| Compound Name | 2-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(2E,4Z)-6-methylocta-2,4-dien-7-yn-3-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 142132996 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(2E,4Z)-6-methylocta-2,4-dien-7-yn-3-yl]-1,3-dioxane |
| SMILES | C#CC(C)/C=C\C(=C/C)C1COC(C2=CC=C(C)C=CC2)OC1 |
| InChI | InChI=1S/C21H26O2/c1-5-16(3)10-12-18(6-2)20-14-22-21(23-15-20)19-9-7-8-17(4)11-13-19/h1,6-8,10-13,16,20-21H,9,14-15H2,2-4H3/b12-10-,18-6+ |
| InChIKey | HCHXEVDJAUUTAI-BPQGJDPYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|