C30H36O4S — CID 142133059
4-[(E)-2-[7-ethyl-5,5,6,9,9-pentamethyl-2-[(E)-2-methylsulfonylethenyl]-8H-benzo[7]annulen-3-yl]ethenyl]benzoic acid (PubChem CID 142133059) has the molecular formula C30H36O4S and a molecular weight of 492.68 g/mol. Its IUPAC name is 4-[(E)-2-[7-ethyl-5,5,6,9,9-pentamethyl-2-[(E)-2-methylsulfonylethenyl]-8H-benzo[7]annulen-3-yl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[7-ethyl-5,5,6,9,9-pentamethyl-2-[(E)-2-methylsulfonylethenyl]-8H-benzo[7]annulen-3-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 142133059 |
| Molecular Formula | C30H36O4S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 4-[(E)-2-[7-ethyl-5,5,6,9,9-pentamethyl-2-[(E)-2-methylsulfonylethenyl]-8H-benzo[7]annulen-3-yl]ethenyl]benzoic acid |
| SMILES | CCC1=C(C)C(C)(C)c2cc(/C=C/c3ccc(C(=O)O)cc3)c(/C=C/S(C)(=O)=O)cc2C(C)(C)C1 |
| InChI | InChI=1S/C30H36O4S/c1-8-22-19-29(3,4)26-17-25(15-16-35(7,33)34)24(18-27(26)30(5,6)20(22)2)14-11-21-9-12-23(13-10-21)28(31)32/h9-18H,8,19H2,1-7H3,(H,31,32)/b14-11+,16-15+ |
| InChIKey | YWBYYYWMJDPITI-LPVXAABHSA-N |
| XLogP | 7.26 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|