C19H20N2 — CID 142133205
1-[(2E)-2-ethenylpenta-2,4-dienyl]-6-methyl-2,3-dihydropyrrolo[2,3-b]quinoline (PubChem CID 142133205) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[(2E)-2-ethenylpenta-2,4-dienyl]-6-methyl-2,3-dihydropyrrolo[2,3-b]quinoline.
| Compound Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-6-methyl-2,3-dihydropyrrolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 142133205 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-6-methyl-2,3-dihydropyrrolo[2,3-b]quinoline |
| SMILES | C=C/C=C(\C=C)CN1CCc2cc3cc(C)ccc3nc21 |
| InChI | InChI=1S/C19H20N2/c1-4-6-15(5-2)13-21-10-9-16-12-17-11-14(3)7-8-18(17)20-19(16)21/h4-8,11-12H,1-2,9-10,13H2,3H3/b15-6+ |
| InChIKey | XPOZPGLXTOTNAQ-GIDUJCDVSA-N |
| XLogP | 4.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|