C10H15NO — CID 142133413
(4Z,7Z)-3,6,6-trimethylazocin-3-ol (PubChem CID 142133413) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (4Z,7Z)-3,6,6-trimethylazocin-3-ol.
| Compound Name | (4Z,7Z)-3,6,6-trimethylazocin-3-ol |
|---|---|
| PubChem CID | 142133413 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (4Z,7Z)-3,6,6-trimethylazocin-3-ol |
| SMILES | CC1(C)/C=C\N=C/C(C)(O)/C=C\1 |
| InChI | InChI=1S/C10H15NO/c1-9(2)4-5-10(3,12)8-11-7-6-9/h4-8,12H,1-3H3/b5-4-,7-6-,11-8- |
| InChIKey | CSCOXIWHXJUMGY-WUIHLBFQSA-N |
| XLogP | 1.92 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|