C13H21NO2 — CID 142133456
ethane;(3Z,5Z)-hepta-1,3,5-triene;pyrrolidine-2,5-dione (PubChem CID 142133456) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;(3Z,5Z)-hepta-1,3,5-triene;pyrrolidine-2,5-dione.
| Compound Name | ethane;(3Z,5Z)-hepta-1,3,5-triene;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 142133456 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethane;(3Z,5Z)-hepta-1,3,5-triene;pyrrolidine-2,5-dione |
| SMILES | C=C/C=C\C=C/C.CC.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C7H10.C4H5NO2.C2H6/c1-3-5-7-6-4-2;6-3-1-2-4(7)5-3;1-2/h3-7H,1H2,2H3;1-2H2,(H,5,6,7);1-2H3/b6-4-,7-5-;; |
| InChIKey | GTDGXKYNLZZPOY-RVMHNBBFSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|