About ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene
ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene (PubChem CID 142133460) has the molecular formula C18H24FNO2
and a molecular weight of 305.39 g/mol. Its IUPAC name is ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene.
Molecular Properties
| Compound Name | ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene |
| PubChem CID | 142133460 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene |
| SMILES | C#C/C(F)=C\C1=C(C)C(=O)NC1=O.C/C=C(/C)CCC.C=C |
| InChI | InChI=1S/C9H6FNO2.C7H14.C2H4/c1-3-6(10)4-7-5(2)8(12)11-9(7)13;1-4-6-7(3)5-2;1-2/h1,4H,2H3,(H,11,12,13);5H,4,6H2,1-3H3;1-2H2/b6-4+;7-5-; |
| InChIKey | KNHMYEQSBLVUSZ-CMRULNJJSA-N |
| XLogP | 4.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene?
The IUPAC name of ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene (CID 142133460) is ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene.
What is the SMILES notation for ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene?
The canonical SMILES for ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene is C#C/C(F)=C\C1=C(C)C(=O)NC1=O.C/C=C(/C)CCC.C=C.
What is the InChIKey of ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene?
The InChIKey is KNHMYEQSBLVUSZ-CMRULNJJSA-N. The full InChI is InChI=1S/C9H6FNO2.C7H14.C2H4/c1-3-6(10)4-7-5(2)8(12)11-9(7)13;1-4-6-7(3)5-2;1-2/h1,4H,2H3,(H,11,12,13);5H,4,6H2,1-3H3;1-2H2/b6-4+;7-5-;.
What are the key properties of ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene?
ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene has a molecular weight of 305.39 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;3-[(E)-2-fluorobut-1-en-3-ynyl]-4-methylpyrrole-2,5-dione;(Z)-3-methylhex-2-ene is sourced from PubChem (CID 142133460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).