C9H13NO2 — CID 142133641
3,6-dimethoxycyclohepta-1,3,6-trien-1-amine (PubChem CID 142133641) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3,6-dimethoxycyclohepta-1,3,6-trien-1-amine.
| Compound Name | 3,6-dimethoxycyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 142133641 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3,6-dimethoxycyclohepta-1,3,6-trien-1-amine |
| SMILES | COC1=CCC(OC)=CC(N)=C1 |
| InChI | InChI=1S/C9H13NO2/c1-11-8-3-4-9(12-2)6-7(10)5-8/h3,5-6H,4,10H2,1-2H3 |
| InChIKey | VMRYVHPFAISBKR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |