C16H23NO — CID 142133649
(3Z,5E)-5-[(3E,6Z)-nona-3,6,8-trien-3-yl]oxyhepta-1,3,5-trien-2-amine (PubChem CID 142133649) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (3Z,5E)-5-[(3E,6Z)-nona-3,6,8-trien-3-yl]oxyhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5-[(3E,6Z)-nona-3,6,8-trien-3-yl]oxyhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142133649 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (3Z,5E)-5-[(3E,6Z)-nona-3,6,8-trien-3-yl]oxyhepta-1,3,5-trien-2-amine |
| SMILES | C=C/C=C\C/C=C(\CC)OC(/C=C\C(=C)N)=C/C |
| InChI | InChI=1S/C16H23NO/c1-5-8-9-10-11-15(6-2)18-16(7-3)13-12-14(4)17/h5,7-9,11-13H,1,4,6,10,17H2,2-3H3/b9-8-,13-12-,15-11+,16-7+ |
| InChIKey | DKRUXWJVFQQSKP-OXFBLJMZSA-N |
| XLogP | 4.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|