About 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine
7,8-dihydrobenzo[g]quinoxaline-2,3-diamine (PubChem CID 142133969) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine.
Molecular Properties
| Compound Name | 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine |
| PubChem CID | 142133969 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine |
| SMILES | Nc1nc2cc3c(cc2nc1N)=CCCC=3 |
| InChI | InChI=1S/C12H12N4/c13-11-12(14)16-10-6-8-4-2-1-3-7(8)5-9(10)15-11/h3-6H,1-2H2,(H2,13,15)(H2,14,16) |
| InChIKey | XUWGNIRCQIYHTG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine?
The IUPAC name of 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine (CID 142133969) is 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine.
What is the SMILES notation for 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine?
The canonical SMILES for 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine is Nc1nc2cc3c(cc2nc1N)=CCCC=3.
What is the InChIKey of 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine?
The InChIKey is XUWGNIRCQIYHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4/c13-11-12(14)16-10-6-8-4-2-1-3-7(8)5-9(10)15-11/h3-6H,1-2H2,(H2,13,15)(H2,14,16).
What are the key properties of 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine?
7,8-dihydrobenzo[g]quinoxaline-2,3-diamine has a molecular weight of 212.26 g/mol, XLogP of 0.15, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine is sourced from PubChem (CID 142133969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).