About 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate
1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate (PubChem CID 142134248) has the molecular formula C22H37N3O2
and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate |
| PubChem CID | 142134248 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate |
| SMILES | C=C(CC)NCCCCCCN(Cc1ccccc1)C(=O)OC(C)N(C)C |
| InChI | InChI=1S/C22H37N3O2/c1-6-19(2)23-16-12-7-8-13-17-25(18-21-14-10-9-11-15-21)22(26)27-20(3)24(4)5/h9-11,14-15,20,23H,2,6-8,12-13,16-18H2,1,3-5H3 |
| InChIKey | PGSZRLUIKCOURI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate?
The IUPAC name of 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate (CID 142134248) is 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate.
What is the SMILES notation for 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate?
The canonical SMILES for 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate is C=C(CC)NCCCCCCN(Cc1ccccc1)C(=O)OC(C)N(C)C.
What is the InChIKey of 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate?
The InChIKey is PGSZRLUIKCOURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37N3O2/c1-6-19(2)23-16-12-7-8-13-17-25(18-21-14-10-9-11-15-21)22(26)27-20(3)24(4)5/h9-11,14-15,20,23H,2,6-8,12-13,16-18H2,1,3-5H3.
What are the key properties of 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate?
1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate has a molecular weight of 375.56 g/mol, XLogP of 4.61, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl N-benzyl-N-[6-(but-1-en-2-ylamino)hexyl]carbamate is sourced from PubChem (CID 142134248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).