About 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol
1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol (PubChem CID 142134267) has the molecular formula C16H20N4O5
and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol.
Molecular Properties
| Compound Name | 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol |
| PubChem CID | 142134267 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol |
| SMILES | O=C(NCc1ccccc1)Nc1ccnc(=O)[nH]1.OCC1OCCO1 |
| InChI | InChI=1S/C12H12N4O2.C4H8O3/c17-11-13-7-6-10(15-11)16-12(18)14-8-9-4-2-1-3-5-9;5-3-4-6-1-2-7-4/h1-7H,8H2,(H3,13,14,15,16,17,18);4-5H,1-3H2 |
| InChIKey | FZTLMZNVUVCKGO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol?
The IUPAC name of 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol (CID 142134267) is 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol.
What is the SMILES notation for 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol?
The canonical SMILES for 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol is O=C(NCc1ccccc1)Nc1ccnc(=O)[nH]1.OCC1OCCO1.
What is the InChIKey of 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol?
The InChIKey is FZTLMZNVUVCKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2.C4H8O3/c17-11-13-7-6-10(15-11)16-12(18)14-8-9-4-2-1-3-5-9;5-3-4-6-1-2-7-4/h1-7H,8H2,(H3,13,14,15,16,17,18);4-5H,1-3H2.
What are the key properties of 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol?
1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol has a molecular weight of 348.36 g/mol, XLogP of 0.44, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(2-oxo-1H-pyrimidin-6-yl)urea;1,3-dioxolan-2-ylmethanol is sourced from PubChem (CID 142134267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).