C26H42N4O6 — CID 142134289
6-amino-1H-pyrimidin-2-one;tert-butyl N-benzyl-N-pentylcarbamate;2-(methoxymethyl)-1,3-dioxolane (PubChem CID 142134289) has the molecular formula C26H42N4O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is 6-amino-1H-pyrimidin-2-one;tert-butyl N-benzyl-N-pentylcarbamate;2-(methoxymethyl)-1,3-dioxolane.
| Compound Name | 6-amino-1H-pyrimidin-2-one;tert-butyl N-benzyl-N-pentylcarbamate;2-(methoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 142134289 |
| Molecular Formula | C26H42N4O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 6-amino-1H-pyrimidin-2-one;tert-butyl N-benzyl-N-pentylcarbamate;2-(methoxymethyl)-1,3-dioxolane |
| SMILES | CCCCCN(Cc1ccccc1)C(=O)OC(C)(C)C.COCC1OCCO1.Nc1ccnc(=O)[nH]1 |
| InChI | InChI=1S/C17H27NO2.C5H10O3.C4H5N3O/c1-5-6-10-13-18(16(19)20-17(2,3)4)14-15-11-8-7-9-12-15;1-6-4-5-7-2-3-8-5;5-3-1-2-6-4(8)7-3/h7-9,11-12H,5-6,10,13-14H2,1-4H3;5H,2-4H2,1H3;1-2H,(H3,5,6,7,8) |
| InChIKey | ZIMUAZBCHMIQQM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|