About 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone
1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone (PubChem CID 142134326) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone.
Molecular Properties
| Compound Name | 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone |
| PubChem CID | 142134326 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone |
| SMILES | CC(=O)C1(O)CC(O)C(C)C(O)C1 |
| InChI | InChI=1S/C9H16O4/c1-5-7(11)3-9(13,6(2)10)4-8(5)12/h5,7-8,11-13H,3-4H2,1-2H3 |
| InChIKey | VUYNWGUNLHFJPL-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone?
The IUPAC name of 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone (CID 142134326) is 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone.
What is the SMILES notation for 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone?
The canonical SMILES for 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone is CC(=O)C1(O)CC(O)C(C)C(O)C1.
What is the InChIKey of 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone?
The InChIKey is VUYNWGUNLHFJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-5-7(11)3-9(13,6(2)10)4-8(5)12/h5,7-8,11-13H,3-4H2,1-2H3.
What are the key properties of 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone?
1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone has a molecular weight of 188.22 g/mol, XLogP of -0.54, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3,5-trihydroxy-4-methylcyclohexyl)ethanone is sourced from PubChem (CID 142134326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).