C10H12N2O — CID 142135189
(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dien-1-ol (PubChem CID 142135189) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is (1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dien-1-ol.
| Compound Name | (1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 142135189 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dien-1-ol |
| SMILES | N/C(=C\C=C(/N)O)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h1-7,13H,11-12H2/b9-6-,10-7+ |
| InChIKey | UOEZHZRQCPWQGB-PCCLLEMOSA-N |
| XLogP | 1.34 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|