C20H19FN4O2S2 — CID 142135337
5-(1,5,2-dithiazepan-2-yl)-N-[(4-fluorophenyl)methyl]-8-hydroxy-1,6-naphthyridine-7-carboxamide (PubChem CID 142135337) has the molecular formula C20H19FN4O2S2 and a molecular weight of 430.53 g/mol. Its IUPAC name is 5-(1,5,2-dithiazepan-2-yl)-N-[(4-fluorophenyl)methyl]-8-hydroxy-1,6-naphthyridine-7-carboxamide.
| Compound Name | 5-(1,5,2-dithiazepan-2-yl)-N-[(4-fluorophenyl)methyl]-8-hydroxy-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 142135337 |
| Molecular Formula | C20H19FN4O2S2 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-(1,5,2-dithiazepan-2-yl)-N-[(4-fluorophenyl)methyl]-8-hydroxy-1,6-naphthyridine-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1nc(N2CCSCCS2)c2cccnc2c1O |
| InChI | InChI=1S/C20H19FN4O2S2/c21-14-5-3-13(4-6-14)12-23-20(27)17-18(26)16-15(2-1-7-22-16)19(24-17)25-8-9-28-10-11-29-25/h1-7,26H,8-12H2,(H,23,27) |
| InChIKey | QPFHLLXQNIECLY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|