C16H28O4S2 — CID 142135512
5-(2-ethylsulfanylethyl)oxan-2-one;4-(2-methylsulfanylethyl)oxolan-2-one (PubChem CID 142135512) has the molecular formula C16H28O4S2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 5-(2-ethylsulfanylethyl)oxan-2-one;4-(2-methylsulfanylethyl)oxolan-2-one.
| Compound Name | 5-(2-ethylsulfanylethyl)oxan-2-one;4-(2-methylsulfanylethyl)oxolan-2-one |
|---|---|
| PubChem CID | 142135512 |
| Molecular Formula | C16H28O4S2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 5-(2-ethylsulfanylethyl)oxan-2-one;4-(2-methylsulfanylethyl)oxolan-2-one |
| SMILES | CCSCCC1CCC(=O)OC1.CSCCC1COC(=O)C1 |
| InChI | InChI=1S/C9H16O2S.C7H12O2S/c1-2-12-6-5-8-3-4-9(10)11-7-8;1-10-3-2-6-4-7(8)9-5-6/h8H,2-7H2,1H3;6H,2-5H2,1H3 |
| InChIKey | GCNFTVVEDJNSFX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|