C32H50N2S8 — CID 142135561
5-[5-[2-[3,3-dimethyl-5-[3-methyl-4-propylsulfanyl-2,6-bis(sulfanylidene)-3H-pyridin-1-yl]pentyl]sulfanylethylsulfanyl]-3,3-dimethylpentyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 142135561) has the molecular formula C32H50N2S8 and a molecular weight of 719.30 g/mol. Its IUPAC name is 5-[5-[2-[3,3-dimethyl-5-[3-methyl-4-propylsulfanyl-2,6-bis(sulfanylidene)-3H-pyridin-1-yl]pentyl]sulfanylethylsulfanyl]-3,3-dimethylpentyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-[5-[2-[3,3-dimethyl-5-[3-methyl-4-propylsulfanyl-2,6-bis(sulfanylidene)-3H-pyridin-1-yl]pentyl]sulfanylethylsulfanyl]-3,3-dimethylpentyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 142135561 |
| Molecular Formula | C32H50N2S8 |
| Molecular Weight | 719.30 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | 5-[5-[2-[3,3-dimethyl-5-[3-methyl-4-propylsulfanyl-2,6-bis(sulfanylidene)-3H-pyridin-1-yl]pentyl]sulfanylethylsulfanyl]-3,3-dimethylpentyl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CCCSC1=CC(=S)N(CCC(C)(C)CCSCCSCCC(C)(C)CCN2C(=S)C=C3SCCC3C2=S)C(=S)C1C |
| InChI | InChI=1S/C32H50N2S8/c1-7-15-41-25-21-27(35)33(29(37)23(25)2)13-9-31(3,4)11-17-39-19-20-40-18-12-32(5,6)10-14-34-28(36)22-26-24(30(34)38)8-16-42-26/h21-24H,7-20H2,1-6H3 |
| InChIKey | FONJGQMPHUHPOK-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.30 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|