About 3-butyloxan-2-one;ethane
3-butyloxan-2-one;ethane (PubChem CID 142135562) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 3-butyloxan-2-one;ethane.
Molecular Properties
| Compound Name | 3-butyloxan-2-one;ethane |
| PubChem CID | 142135562 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 3-butyloxan-2-one;ethane |
| SMILES | CC.CCCCC1CCCOC1=O |
| InChI | InChI=1S/C9H16O2.C2H6/c1-2-3-5-8-6-4-7-11-9(8)10;1-2/h8H,2-7H2,1H3;1-2H3 |
| InChIKey | PLRJGUIDWAJQBI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyloxan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyloxan-2-one;ethane?
The IUPAC name of 3-butyloxan-2-one;ethane (CID 142135562) is 3-butyloxan-2-one;ethane.
What is the SMILES notation for 3-butyloxan-2-one;ethane?
The canonical SMILES for 3-butyloxan-2-one;ethane is CC.CCCCC1CCCOC1=O.
What is the InChIKey of 3-butyloxan-2-one;ethane?
The InChIKey is PLRJGUIDWAJQBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2.C2H6/c1-2-3-5-8-6-4-7-11-9(8)10;1-2/h8H,2-7H2,1H3;1-2H3.
What are the key properties of 3-butyloxan-2-one;ethane?
3-butyloxan-2-one;ethane has a molecular weight of 186.29 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyloxan-2-one;ethane is sourced from PubChem (CID 142135562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).