C7H9NS2 — CID 142135788
3,3a,4,5-tetrahydro-2H-thieno[3,2-c]pyridine-6-thione (PubChem CID 142135788) has the molecular formula C7H9NS2 and a molecular weight of 171.29 g/mol. Its IUPAC name is 3,3a,4,5-tetrahydro-2H-thieno[3,2-c]pyridine-6-thione.
| Compound Name | 3,3a,4,5-tetrahydro-2H-thieno[3,2-c]pyridine-6-thione |
|---|---|
| PubChem CID | 142135788 |
| Molecular Formula | C7H9NS2 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 3,3a,4,5-tetrahydro-2H-thieno[3,2-c]pyridine-6-thione |
| SMILES | S=C1C=C2SCCC2CN1 |
| InChI | InChI=1S/C7H9NS2/c9-7-3-6-5(4-8-7)1-2-10-6/h3,5H,1-2,4H2,(H,8,9) |
| InChIKey | DPNOXODCVHWZPK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|