About (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid
(3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid (PubChem CID 14213614) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid.
Molecular Properties
| Compound Name | (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid |
| PubChem CID | 14213614 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid |
| SMILES | O=C(O)C[C@H](O)[C@@H]1NCC[C@H]1O |
| InChI | InChI=1S/C7H13NO4/c9-4-1-2-8-7(4)5(10)3-6(11)12/h4-5,7-10H,1-3H2,(H,11,12)/t4-,5+,7-/m1/s1 |
| InChIKey | VBNASWCFBIYQKR-JCGDXUMPSA-N |
| XLogP | -1.46 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid?
The IUPAC name of (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid (CID 14213614) is (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid.
What is the SMILES notation for (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid?
The canonical SMILES for (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid is O=C(O)C[C@H](O)[C@@H]1NCC[C@H]1O.
What is the InChIKey of (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid?
The InChIKey is VBNASWCFBIYQKR-JCGDXUMPSA-N. The full InChI is InChI=1S/C7H13NO4/c9-4-1-2-8-7(4)5(10)3-6(11)12/h4-5,7-10H,1-3H2,(H,11,12)/t4-,5+,7-/m1/s1.
What are the key properties of (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid?
(3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid has a molecular weight of 175.18 g/mol, XLogP of -1.46, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxy-3-[(2R,3R)-3-hydroxypyrrolidin-2-yl]propanoic acid is sourced from PubChem (CID 14213614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).