C35H34F3N3O5 — CID 142136201
5-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]-3-(4-methoxyphenyl)-1-[(2E,4E)-2-methyl-4-(trifluoromethyl)hexa-2,4-dienyl]indole-2-carboxylic acid (PubChem CID 142136201) has the molecular formula C35H34F3N3O5 and a molecular weight of 633.67 g/mol. Its IUPAC name is 5-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]-3-(4-methoxyphenyl)-1-[(2E,4E)-2-methyl-4-(trifluoromethyl)hexa-2,4-dienyl]indole-2-carboxylic acid.
| Compound Name | 5-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]-3-(4-methoxyphenyl)-1-[(2E,4E)-2-methyl-4-(trifluoromethyl)hexa-2,4-dienyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 142136201 |
| Molecular Formula | C35H34F3N3O5 |
| Molecular Weight | 633.67 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | 5-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]-3-(4-methoxyphenyl)-1-[(2E,4E)-2-methyl-4-(trifluoromethyl)hexa-2,4-dienyl]indole-2-carboxylic acid |
| SMILES | C/C=C(\C=C(/C)Cn1c(C(=O)O)c(-c2ccc(OC)cc2)c2cc(OCCCN(C)c3nc4ccccc4o3)ccc21)C(F)(F)F |
| InChI | InChI=1S/C35H34F3N3O5/c1-5-24(35(36,37)38)19-22(2)21-41-29-16-15-26(45-18-8-17-40(3)34-39-28-9-6-7-10-30(28)46-34)20-27(29)31(32(41)33(42)43)23-11-13-25(44-4)14-12-23/h5-7,9-16,19-20H,8,17-18,21H2,1-4H3,(H,42,43)/b22-19+,24-5+ |
| InChIKey | VGNCYOYYTGZECN-MUVGVCFSSA-N |
| XLogP | 8.52 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.67 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|