About 2-methyl-1,3-dioctoxypropan-2-amine
2-methyl-1,3-dioctoxypropan-2-amine (PubChem CID 142136398) has the molecular formula C20H43NO2
and a molecular weight of 329.57 g/mol. Its IUPAC name is 2-methyl-1,3-dioctoxypropan-2-amine.
Molecular Properties
| Compound Name | 2-methyl-1,3-dioctoxypropan-2-amine |
| PubChem CID | 142136398 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | 2-methyl-1,3-dioctoxypropan-2-amine |
| SMILES | CCCCCCCCOCC(C)(N)COCCCCCCCC |
| InChI | InChI=1S/C20H43NO2/c1-4-6-8-10-12-14-16-22-18-20(3,21)19-23-17-15-13-11-9-7-5-2/h4-19,21H2,1-3H3 |
| InChIKey | PISXKSYCDVTWSP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,3-dioctoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-dioctoxypropan-2-amine?
The IUPAC name of 2-methyl-1,3-dioctoxypropan-2-amine (CID 142136398) is 2-methyl-1,3-dioctoxypropan-2-amine.
What is the SMILES notation for 2-methyl-1,3-dioctoxypropan-2-amine?
The canonical SMILES for 2-methyl-1,3-dioctoxypropan-2-amine is CCCCCCCCOCC(C)(N)COCCCCCCCC.
What is the InChIKey of 2-methyl-1,3-dioctoxypropan-2-amine?
The InChIKey is PISXKSYCDVTWSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43NO2/c1-4-6-8-10-12-14-16-22-18-20(3,21)19-23-17-15-13-11-9-7-5-2/h4-19,21H2,1-3H3.
What are the key properties of 2-methyl-1,3-dioctoxypropan-2-amine?
2-methyl-1,3-dioctoxypropan-2-amine has a molecular weight of 329.57 g/mol, XLogP of 5.46, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-dioctoxypropan-2-amine is sourced from PubChem (CID 142136398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).